C29H50N3O3S+ — CID 172567652
[cyclobutyl-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] decanoate (PubChem CID 172567652) has the molecular formula C29H50N3O3S+ and a molecular weight of 520.80 g/mol. Its IUPAC name is [cyclobutyl-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] decanoate.
| Compound Name | [cyclobutyl-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] decanoate |
|---|---|
| PubChem CID | 172567652 |
| Molecular Formula | C29H50N3O3S+ |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | [cyclobutyl-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C1CCC1)[N+]1(C)CCC=C(c2nsnc2OCCCCCC)C1 |
| InChI | InChI=1S/C29H50N3O3S/c1-4-6-8-10-11-12-13-20-26(33)35-29(24-17-15-18-24)32(3)21-16-19-25(23-32)27-28(31-36-30-27)34-22-14-9-7-5-2/h19,24,29H,4-18,20-23H2,1-3H3/q+1 |
| InChIKey | ZTFBBUZSLUYXGQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|