C27H40N3O5S+ — CID 177225999
[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] hexyl carbonate (PubChem CID 177225999) has the molecular formula C27H40N3O5S+ and a molecular weight of 518.70 g/mol. Its IUPAC name is [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] hexyl carbonate.
| Compound Name | [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] hexyl carbonate |
|---|---|
| PubChem CID | 177225999 |
| Molecular Formula | C27H40N3O5S+ |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] hexyl carbonate |
| SMILES | CCCCCCOC(=O)OC(c1ccccc1)[N+]1(O)CCC=C(c2nsnc2OCCCCCC)C1 |
| InChI | InChI=1S/C27H40N3O5S/c1-3-5-7-12-19-33-25-24(28-36-29-25)23-17-14-18-30(32,21-23)26(22-15-10-9-11-16-22)35-27(31)34-20-13-8-6-4-2/h9-11,15-17,26,32H,3-8,12-14,18-21H2,1-2H3/q+1 |
| InChIKey | JVDZIQXQEVXWQD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|