C27H38IN3O5S — CID 172566772
[2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] 2-methylpropanoate iodide (PubChem CID 172566772) has the molecular formula C27H38IN3O5S and a molecular weight of 643.59 g/mol. Its IUPAC name is [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] 2-methylpropanoate iodide.
| Compound Name | [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] 2-methylpropanoate iodide |
|---|---|
| PubChem CID | 172566772 |
| Molecular Formula | C27H38IN3O5S |
| Molecular Weight | 643.59 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] 2-methylpropanoate iodide |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(COC(=O)Cc2ccccc2OC(=O)C(C)C)C1.[I-] |
| InChI | InChI=1S/C27H38N3O5S.HI/c1-5-6-7-10-16-33-26-25(28-36-29-26)22-13-11-15-30(4,18-22)19-34-24(31)17-21-12-8-9-14-23(21)35-27(32)20(2)3;/h8-9,12-14,20H,5-7,10-11,15-19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GCOMWOHBWUWDNG-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|