C25H43IN4O5S — CID 172567058
[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate iodide (PubChem CID 172567058) has the molecular formula C25H43IN4O5S and a molecular weight of 638.61 g/mol. Its IUPAC name is [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate iodide.
| Compound Name | [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate iodide |
|---|---|
| PubChem CID | 172567058 |
| Molecular Formula | C25H43IN4O5S |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate iodide |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(COC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C1.[I-] |
| InChI | InChI=1S/C25H42N4O5S.HI/c1-8-9-10-11-15-32-22-21(27-35-28-22)19-13-12-14-29(7,16-19)17-33-23(30)20(18(2)3)26-24(31)34-25(4,5)6;/h13,18,20H,8-12,14-17H2,1-7H3;1H/t20-,29?;/m0./s1 |
| InChIKey | SKPQIRBXGKGOJO-WGBWPRDJSA-N |
| XLogP | 1.78 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|