C25H34N2O6PS+ — CID 177226184
[2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-phosphinin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] propanoate (PubChem CID 177226184) has the molecular formula C25H34N2O6PS+ and a molecular weight of 521.60 g/mol. Its IUPAC name is [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-phosphinin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] propanoate.
| Compound Name | [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-phosphinin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] propanoate |
|---|---|
| PubChem CID | 177226184 |
| Molecular Formula | C25H34N2O6PS+ |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | [2-[2-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-hydroxy-3,6-dihydro-2H-phosphinin-1-ium-1-yl]methoxy]-2-oxoethyl]phenyl] propanoate |
| SMILES | CCCCCCOc1nsnc1C1=CCC[P+](O)(COC(=O)Cc2ccccc2OC(=O)CC)C1 |
| InChI | InChI=1S/C25H34N2O6PS/c1-3-5-6-9-14-31-25-24(26-35-27-25)20-12-10-15-34(30,17-20)18-32-23(29)16-19-11-7-8-13-21(19)33-22(28)4-2/h7-8,11-13,30H,3-6,9-10,14-18H2,1-2H3/q+1 |
| InChIKey | XJVFZFOUURMVGA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|