C23H36N2O4S — CID 177225833
[3-[3-(4-hexoxy-1,2,5-thiadiazol-3-yl)cyclohex-3-en-1-yl]-2-methylpropyl] 4-oxopentanoate (PubChem CID 177225833) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is [3-[3-(4-hexoxy-1,2,5-thiadiazol-3-yl)cyclohex-3-en-1-yl]-2-methylpropyl] 4-oxopentanoate.
| Compound Name | [3-[3-(4-hexoxy-1,2,5-thiadiazol-3-yl)cyclohex-3-en-1-yl]-2-methylpropyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 177225833 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [3-[3-(4-hexoxy-1,2,5-thiadiazol-3-yl)cyclohex-3-en-1-yl]-2-methylpropyl] 4-oxopentanoate |
| SMILES | CCCCCCOc1nsnc1C1=CCCC(CC(C)COC(=O)CCC(C)=O)C1 |
| InChI | InChI=1S/C23H36N2O4S/c1-4-5-6-7-13-28-23-22(24-30-25-23)20-10-8-9-19(15-20)14-17(2)16-29-21(27)12-11-18(3)26/h10,17,19H,4-9,11-16H2,1-3H3 |
| InChIKey | MUPIPWJPNFVYFR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|