C21H28N3O3S+ — CID 177226657
[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]methyl benzoate (PubChem CID 177226657) has the molecular formula C21H28N3O3S+ and a molecular weight of 402.54 g/mol. Its IUPAC name is [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]methyl benzoate.
| Compound Name | [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 177226657 |
| Molecular Formula | C21H28N3O3S+ |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1,2,3,6-tetrahydropyridin-1-ium-1-yl]methyl benzoate |
| SMILES | CCCCCCOc1nsnc1C1=CCC[NH+](COC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C21H27N3O3S/c1-2-3-4-8-14-26-20-19(22-28-23-20)18-12-9-13-24(15-18)16-27-21(25)17-10-6-5-7-11-17/h5-7,10-12H,2-4,8-9,13-16H2,1H3/p+1 |
| InChIKey | ZQDVJUPUUQMJIE-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|