C29H48N3O5S+ — CID 177224660
butyl [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] carbonate;ethane;methanol (PubChem CID 177224660) has the molecular formula C29H48N3O5S+ and a molecular weight of 550.79 g/mol. Its IUPAC name is butyl [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] carbonate;ethane;methanol.
| Compound Name | butyl [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] carbonate;ethane;methanol |
|---|---|
| PubChem CID | 177224660 |
| Molecular Formula | C29H48N3O5S+ |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | butyl [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-phenylmethyl] carbonate;ethane;methanol |
| SMILES | CC.CCCCCCOc1nsnc1C1=CCC[N+](C)(C(OC(=O)OCCCC)c2ccccc2)C1.CO |
| InChI | InChI=1S/C26H38N3O4S.C2H6.CH4O/c1-4-6-8-12-19-31-24-23(27-34-28-24)22-16-13-17-29(3,20-22)25(21-14-10-9-11-15-21)33-26(30)32-18-7-5-2;2*1-2/h9-11,14-16,25H,4-8,12-13,17-20H2,1-3H3;1-2H3;2H,1H3/q+1;; |
| InChIKey | MUMVSIMNPBTSDS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|