C23H33N4O3S+ — CID 172567406
[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-pyridin-3-ylmethyl] propanoate (PubChem CID 172567406) has the molecular formula C23H33N4O3S+ and a molecular weight of 445.61 g/mol. Its IUPAC name is [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-pyridin-3-ylmethyl] propanoate.
| Compound Name | [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-pyridin-3-ylmethyl] propanoate |
|---|---|
| PubChem CID | 172567406 |
| Molecular Formula | C23H33N4O3S+ |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-pyridin-3-ylmethyl] propanoate |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(C(OC(=O)CC)c2cccnc2)C1 |
| InChI | InChI=1S/C23H33N4O3S/c1-4-6-7-8-15-29-22-21(25-31-26-22)19-12-10-14-27(3,17-19)23(30-20(28)5-2)18-11-9-13-24-16-18/h9,11-13,16,23H,4-8,10,14-15,17H2,1-3H3/q+1 |
| InChIKey | ALPZKFFOPYKLGE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|