C19H28N3O4S+ — CID 172566603
4-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl]-5-methyl-1,3-dioxol-2-one (PubChem CID 172566603) has the molecular formula C19H28N3O4S+ and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl]-5-methyl-1,3-dioxol-2-one.
| Compound Name | 4-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl]-5-methyl-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 172566603 |
| Molecular Formula | C19H28N3O4S+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl]-5-methyl-1,3-dioxol-2-one |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(Cc2oc(=O)oc2C)C1 |
| InChI | InChI=1S/C19H28N3O4S/c1-4-5-6-7-11-24-18-17(20-27-21-18)15-9-8-10-22(3,12-15)13-16-14(2)25-19(23)26-16/h9H,4-8,10-13H2,1-3H3/q+1 |
| InChIKey | NFYJNTKIYITQCD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|