C29H49IN4O7S — CID 172566988
5-O-tert-butyl 1-O-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate iodide (PubChem CID 172566988) has the molecular formula C29H49IN4O7S and a molecular weight of 724.70 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate iodide.
| Compound Name | 5-O-tert-butyl 1-O-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate iodide |
|---|---|
| PubChem CID | 172566988 |
| Molecular Formula | C29H49IN4O7S |
| Molecular Weight | 724.70 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | 5-O-tert-butyl 1-O-[[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate iodide |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(COC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C1.[I-] |
| InChI | InChI=1S/C29H48N4O7S.HI/c1-9-10-11-12-18-37-25-24(31-41-32-25)21-14-13-17-33(8,19-21)20-38-26(35)22(30-27(36)40-29(5,6)7)15-16-23(34)39-28(2,3)4;/h14,22H,9-13,15-20H2,1-8H3;1H/t22-,33?;/m0./s1 |
| InChIKey | CUAKRTLQFQKMHY-DRHVDYARSA-N |
| XLogP | 2.25 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|