C14H20N3O2S+ — CID 146509622
5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methylpyridin-1-ium-3-ol (PubChem CID 146509622) has the molecular formula C14H20N3O2S+ and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methylpyridin-1-ium-3-ol.
| Compound Name | 5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methylpyridin-1-ium-3-ol |
|---|---|
| PubChem CID | 146509622 |
| Molecular Formula | C14H20N3O2S+ |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methylpyridin-1-ium-3-ol |
| SMILES | CCCCCCOc1nsnc1-c1cc(O)c[n+](C)c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-3-4-5-6-7-19-14-13(15-20-16-14)11-8-12(18)10-17(2)9-11/h8-10H,3-7H2,1-2H3/p+1 |
| InChIKey | SIFVYTQMWSLHLJ-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|