About 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide
3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide (PubChem CID 139798069) has the molecular formula C14H20IN3O3S
and a molecular weight of 437.30 g/mol. Its IUPAC name is 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide.
Molecular Properties
| Compound Name | 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide |
| PubChem CID | 139798069 |
| Molecular Formula | C14H20IN3O3S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide |
| SMILES | CCOCCOCCOc1nsnc1-c1cc[n+](C)cc1.[I-] |
| InChI | InChI=1S/C14H20N3O3S.HI/c1-3-18-8-9-19-10-11-20-14-13(15-21-16-14)12-4-6-17(2)7-5-12;/h4-7H,3,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PHFBHTLJGYNWLE-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 57.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide?
The IUPAC name of 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide (CID 139798069) is 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide.
What is the SMILES notation for 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide?
The canonical SMILES for 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide is CCOCCOCCOc1nsnc1-c1cc[n+](C)cc1.[I-].
What is the InChIKey of 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide?
The InChIKey is PHFBHTLJGYNWLE-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H20N3O3S.HI/c1-3-18-8-9-19-10-11-20-14-13(15-21-16-14)12-4-6-17(2)7-5-12;/h4-7H,3,8-11H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide?
3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide has a molecular weight of 437.30 g/mol, XLogP of -1.53, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-ethoxyethoxy)ethoxy]-4-(1-methylpyridin-1-ium-4-yl)-1,2,5-thiadiazole iodide is sourced from PubChem (CID 139798069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).