C10H11ClN2O2S — CID 103319718
2-chloro-4-(2-ethoxyethoxy)thieno[2,3-d]pyrimidine (PubChem CID 103319718) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is 2-chloro-4-(2-ethoxyethoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(2-ethoxyethoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319718 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2-chloro-4-(2-ethoxyethoxy)thieno[2,3-d]pyrimidine |
| SMILES | CCOCCOc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C10H11ClN2O2S/c1-2-14-4-5-15-8-7-3-6-16-9(7)13-10(11)12-8/h3,6H,2,4-5H2,1H3 |
| InChIKey | PPYZLQLYUFUNLM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|