C10H16Cl2N2O2 — CID 153387391
2,5-dichloro-4-(2-ethoxyethoxy)pyrimidine;ethane (PubChem CID 153387391) has the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.16 g/mol. Its IUPAC name is 2,5-dichloro-4-(2-ethoxyethoxy)pyrimidine;ethane.
| Compound Name | 2,5-dichloro-4-(2-ethoxyethoxy)pyrimidine;ethane |
|---|---|
| PubChem CID | 153387391 |
| Molecular Formula | C10H16Cl2N2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2,5-dichloro-4-(2-ethoxyethoxy)pyrimidine;ethane |
| SMILES | CC.CCOCCOc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O2.C2H6/c1-2-13-3-4-14-7-6(9)5-11-8(10)12-7;1-2/h5H,2-4H2,1H3;1-2H3 |
| InChIKey | MWSLNNBVGSRTEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|