C14H19ClN2O2S — CID 103319783
4-(2-butoxyethoxy)-2-chloro-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 103319783) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 4-(2-butoxyethoxy)-2-chloro-6-ethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(2-butoxyethoxy)-2-chloro-6-ethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319783 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-(2-butoxyethoxy)-2-chloro-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCCCOCCOc1nc(Cl)nc2sc(CC)cc12 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-3-5-6-18-7-8-19-12-11-9-10(4-2)20-13(11)17-14(15)16-12/h9H,3-8H2,1-2H3 |
| InChIKey | SXJCXHFHBNOLPV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|