C10H13N3O2S — CID 103331574
2-(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)oxyethanol (PubChem CID 103331574) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)oxyethanol.
| Compound Name | 2-(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)oxyethanol |
|---|---|
| PubChem CID | 103331574 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-(2-amino-6-ethylthieno[2,3-d]pyrimidin-4-yl)oxyethanol |
| SMILES | CCc1cc2c(OCCO)nc(N)nc2s1 |
| InChI | InChI=1S/C10H13N3O2S/c1-2-6-5-7-8(15-4-3-14)12-10(11)13-9(7)16-6/h5,14H,2-4H2,1H3,(H2,11,12,13) |
| InChIKey | GUHJXAZADBNKSF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |