C13H12N4OS — CID 103331942
6-ethyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331942) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-ethyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-ethyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331942 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 6-ethyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1cc2c(Oc3cccnc3)nc(N)nc2s1 |
| InChI | InChI=1S/C13H12N4OS/c1-2-9-6-10-11(16-13(14)17-12(10)19-9)18-8-4-3-5-15-7-8/h3-7H,2H2,1H3,(H2,14,16,17) |
| InChIKey | IPCKYNQLGXKULX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |