C12H10N4OS — CID 103331947
6-methyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331947) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 6-methyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-methyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331947 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 6-methyl-4-pyridin-3-yloxythieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc2c(Oc3cccnc3)nc(N)nc2s1 |
| InChI | InChI=1S/C12H10N4OS/c1-7-5-9-10(15-12(13)16-11(9)18-7)17-8-3-2-4-14-6-8/h2-6H,1H3,(H2,13,15,16) |
| InChIKey | VMYLHSORIPPHNG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |