C15H15N3OS — CID 103332009
4-(2-ethylphenoxy)-6-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332009) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-(2-ethylphenoxy)-6-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2-ethylphenoxy)-6-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332009 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-(2-ethylphenoxy)-6-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1ccccc1Oc1nc(N)nc2sc(C)cc12 |
| InChI | InChI=1S/C15H15N3OS/c1-3-10-6-4-5-7-12(10)19-13-11-8-9(2)20-14(11)18-15(16)17-13/h4-8H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | QUFKJCJWMPDVSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |