C15H14ClN3OS — CID 103319823
2-chloro-6-ethyl-4-(2-pyridin-2-ylethoxy)thieno[2,3-d]pyrimidine (PubChem CID 103319823) has the molecular formula C15H14ClN3OS and a molecular weight of 319.82 g/mol. Its IUPAC name is 2-chloro-6-ethyl-4-(2-pyridin-2-ylethoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-ethyl-4-(2-pyridin-2-ylethoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319823 |
| Molecular Formula | C15H14ClN3OS |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-chloro-6-ethyl-4-(2-pyridin-2-ylethoxy)thieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(OCCc3ccccn3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C15H14ClN3OS/c1-2-11-9-12-13(18-15(16)19-14(12)21-11)20-8-6-10-5-3-4-7-17-10/h3-5,7,9H,2,6,8H2,1H3 |
| InChIKey | GMGPXAFJXAOEDG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |