C15H13ClN2OS — CID 103319922
2-chloro-6-ethyl-4-(2-methylphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 103319922) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-chloro-6-ethyl-4-(2-methylphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-6-ethyl-4-(2-methylphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319922 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-chloro-6-ethyl-4-(2-methylphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(Oc3ccccc3C)nc(Cl)nc2s1 |
| InChI | InChI=1S/C15H13ClN2OS/c1-3-10-8-11-13(17-15(16)18-14(11)20-10)19-12-7-5-4-6-9(12)2/h4-8H,3H2,1-2H3 |
| InChIKey | WGXOJBYQKRVGCT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |