C8H5ClF2N2OS — CID 103320209
2-chloro-4-(2,2-difluoroethoxy)thieno[2,3-d]pyrimidine (PubChem CID 103320209) has the molecular formula C8H5ClF2N2OS and a molecular weight of 250.66 g/mol. Its IUPAC name is 2-chloro-4-(2,2-difluoroethoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(2,2-difluoroethoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103320209 |
| Molecular Formula | C8H5ClF2N2OS |
| Molecular Weight | 250.66 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 2-chloro-4-(2,2-difluoroethoxy)thieno[2,3-d]pyrimidine |
| SMILES | FC(F)COc1nc(Cl)nc2sccc12 |
| InChI | InChI=1S/C8H5ClF2N2OS/c9-8-12-6(14-3-5(10)11)4-1-2-15-7(4)13-8/h1-2,5H,3H2 |
| InChIKey | UUQSBVAMZSWCQR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |