C13H8BrClN2OS — CID 103319776
4-(2-bromo-4-methylphenoxy)-2-chlorothieno[2,3-d]pyrimidine (PubChem CID 103319776) has the molecular formula C13H8BrClN2OS and a molecular weight of 355.64 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-2-chlorothieno[2,3-d]pyrimidine.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-2-chlorothieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 103319776 |
| Molecular Formula | C13H8BrClN2OS |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-2-chlorothieno[2,3-d]pyrimidine |
| SMILES | Cc1ccc(Oc2nc(Cl)nc3sccc23)c(Br)c1 |
| InChI | InChI=1S/C13H8BrClN2OS/c1-7-2-3-10(9(14)6-7)18-11-8-4-5-19-12(8)17-13(15)16-11/h2-6H,1H3 |
| InChIKey | PPNCQLWXULIKLW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |