C18H16N6O3S2 — CID 10928093
3-pyridin-3-yl-4-[2-[2-[(4-pyridin-3-yl-1,2,5-thiadiazol-3-yl)oxy]ethoxy]ethoxy]-1,2,5-thiadiazole (PubChem CID 10928093) has the molecular formula C18H16N6O3S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-pyridin-3-yl-4-[2-[2-[(4-pyridin-3-yl-1,2,5-thiadiazol-3-yl)oxy]ethoxy]ethoxy]-1,2,5-thiadiazole.
| Compound Name | 3-pyridin-3-yl-4-[2-[2-[(4-pyridin-3-yl-1,2,5-thiadiazol-3-yl)oxy]ethoxy]ethoxy]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 10928093 |
| Molecular Formula | C18H16N6O3S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-pyridin-3-yl-4-[2-[2-[(4-pyridin-3-yl-1,2,5-thiadiazol-3-yl)oxy]ethoxy]ethoxy]-1,2,5-thiadiazole |
| SMILES | c1cncc(-c2nsnc2OCCOCCOc2nsnc2-c2cccnc2)c1 |
| InChI | InChI=1S/C18H16N6O3S2/c1-3-13(11-19-5-1)15-17(23-28-21-15)26-9-7-25-8-10-27-18-16(22-29-24-18)14-4-2-6-20-12-14/h1-6,11-12H,7-10H2 |
| InChIKey | RTXXMDMYHBLLNH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|