C14H25N3OS — CID 177224992
(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-N,N-dimethylbut-2-en-1-amine (PubChem CID 177224992) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is (E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-N,N-dimethylbut-2-en-1-amine.
| Compound Name | (E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-N,N-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 177224992 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-N,N-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(\CN(C)C)c1nsnc1OCCCCCC |
| InChI | InChI=1S/C14H25N3OS/c1-5-7-8-9-10-18-14-13(15-19-16-14)12(6-2)11-17(3)4/h6H,5,7-11H2,1-4H3/b12-6+ |
| InChIKey | FEDNNWUBOWFEBG-WUXMJOGZSA-N |
| XLogP | 3.46 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|