C23H45N3O3S — CID 177224641
ethane;[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)hept-2-enyl]-methylamino]methyl acetate (PubChem CID 177224641) has the molecular formula C23H45N3O3S and a molecular weight of 443.70 g/mol. Its IUPAC name is ethane;[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)hept-2-enyl]-methylamino]methyl acetate.
| Compound Name | ethane;[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)hept-2-enyl]-methylamino]methyl acetate |
|---|---|
| PubChem CID | 177224641 |
| Molecular Formula | C23H45N3O3S |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | ethane;[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)hept-2-enyl]-methylamino]methyl acetate |
| SMILES | CC.CC.CCCC/C=C(\CN(C)COC(C)=O)c1nsnc1OCCCCCC |
| InChI | InChI=1S/C19H33N3O3S.2C2H6/c1-5-7-9-11-13-24-19-18(20-26-21-19)17(12-10-8-6-2)14-22(4)15-25-16(3)23;2*1-2/h12H,5-11,13-15H2,1-4H3;2*1-2H3/b17-12+;; |
| InChIKey | FYRXUTFHKISETE-CWQUOYFRSA-N |
| XLogP | 6.58 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|