C7H11ClN2OS — CID 10703512
3-chloro-4-pentoxy-1,2,5-thiadiazole (PubChem CID 10703512) has the molecular formula C7H11ClN2OS and a molecular weight of 206.70 g/mol. Its IUPAC name is 3-chloro-4-pentoxy-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-pentoxy-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 10703512 |
| Molecular Formula | C7H11ClN2OS |
| Molecular Weight | 206.70 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 3-chloro-4-pentoxy-1,2,5-thiadiazole |
| SMILES | CCCCCOc1nsnc1Cl |
| InChI | InChI=1S/C7H11ClN2OS/c1-2-3-4-5-11-7-6(8)9-12-10-7/h2-5H2,1H3 |
| InChIKey | LCIXELKKGRTCSN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|