About 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole
3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole (PubChem CID 106794851) has the molecular formula C6H5ClN2OS
and a molecular weight of 188.64 g/mol. Its IUPAC name is 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole |
| PubChem CID | 106794851 |
| Molecular Formula | C6H5ClN2OS |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole |
| SMILES | C#CCCOc1nsnc1Cl |
| InChI | InChI=1S/C6H5ClN2OS/c1-2-3-4-10-6-5(7)8-11-9-6/h1H,3-4H2 |
| InChIKey | BGWFRHAJQPCZHT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole?
The IUPAC name of 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole (CID 106794851) is 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole.
What is the SMILES notation for 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole?
The canonical SMILES for 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole is C#CCCOc1nsnc1Cl.
What is the InChIKey of 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole?
The InChIKey is BGWFRHAJQPCZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2OS/c1-2-3-4-10-6-5(7)8-11-9-6/h1H,3-4H2.
What are the key properties of 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole?
3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole has a molecular weight of 188.64 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-ynoxy-4-chloro-1,2,5-thiadiazole is sourced from PubChem (CID 106794851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).