C5H7ClN2OS — CID 43808056
3-chloro-4-propan-2-yloxy-1,2,5-thiadiazole (PubChem CID 43808056) has the molecular formula C5H7ClN2OS and a molecular weight of 178.64 g/mol. Its IUPAC name is 3-chloro-4-propan-2-yloxy-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-propan-2-yloxy-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43808056 |
| Molecular Formula | C5H7ClN2OS |
| Molecular Weight | 178.64 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 3-chloro-4-propan-2-yloxy-1,2,5-thiadiazole |
| SMILES | CC(C)Oc1nsnc1Cl |
| InChI | InChI=1S/C5H7ClN2OS/c1-3(2)9-5-4(6)7-10-8-5/h3H,1-2H3 |
| InChIKey | AWWWAQNWEDIJBN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |