C6H5ClN2OS — CID 154124642
3-but-2-ynoxy-4-chloro-1,2,5-thiadiazole (PubChem CID 154124642) has the molecular formula C6H5ClN2OS and a molecular weight of 188.64 g/mol. Its IUPAC name is 3-but-2-ynoxy-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-but-2-ynoxy-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 154124642 |
| Molecular Formula | C6H5ClN2OS |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | 3-but-2-ynoxy-4-chloro-1,2,5-thiadiazole |
| SMILES | CC#CCOc1nsnc1Cl |
| InChI | InChI=1S/C6H5ClN2OS/c1-2-3-4-10-6-5(7)8-11-9-6/h4H2,1H3 |
| InChIKey | DDQHLKLRCTUFRW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|