C5H7ClN2O2S — CID 43808053
3-chloro-4-(2-methoxyethoxy)-1,2,5-thiadiazole (PubChem CID 43808053) has the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. Its IUPAC name is 3-chloro-4-(2-methoxyethoxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(2-methoxyethoxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 43808053 |
| Molecular Formula | C5H7ClN2O2S |
| Molecular Weight | 194.64 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | 3-chloro-4-(2-methoxyethoxy)-1,2,5-thiadiazole |
| SMILES | COCCOc1nsnc1Cl |
| InChI | InChI=1S/C5H7ClN2O2S/c1-9-2-3-10-5-4(6)7-11-8-5/h2-3H2,1H3 |
| InChIKey | LVJPOMZYBZSIKH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.64 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|