C4H4Cl2N2OS — CID 18988297
3-chloro-4-(1-chloroethoxy)-1,2,5-thiadiazole (PubChem CID 18988297) has the molecular formula C4H4Cl2N2OS and a molecular weight of 199.06 g/mol. Its IUPAC name is 3-chloro-4-(1-chloroethoxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(1-chloroethoxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 18988297 |
| Molecular Formula | C4H4Cl2N2OS |
| Molecular Weight | 199.06 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | 3-chloro-4-(1-chloroethoxy)-1,2,5-thiadiazole |
| SMILES | CC(Cl)Oc1nsnc1Cl |
| InChI | InChI=1S/C4H4Cl2N2OS/c1-2(5)9-4-3(6)7-10-8-4/h2H,1H3 |
| InChIKey | GPMQOACTZZETAX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|