C25H39N3O5S2 — CID 177226143
[[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-5-hydroxypent-2-enyl]-methylamino]-phenylmethyl] ethylsulfanylformate;methanol (PubChem CID 177226143) has the molecular formula C25H39N3O5S2 and a molecular weight of 525.74 g/mol. Its IUPAC name is [[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-5-hydroxypent-2-enyl]-methylamino]-phenylmethyl] ethylsulfanylformate;methanol.
| Compound Name | [[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-5-hydroxypent-2-enyl]-methylamino]-phenylmethyl] ethylsulfanylformate;methanol |
|---|---|
| PubChem CID | 177226143 |
| Molecular Formula | C25H39N3O5S2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [[[(E)-2-(4-hexoxy-1,2,5-thiadiazol-3-yl)-5-hydroxypent-2-enyl]-methylamino]-phenylmethyl] ethylsulfanylformate;methanol |
| SMILES | CCCCCCOc1nsnc1/C(=C/CCO)CN(C)C(OC(=O)SCC)c1ccccc1.CO |
| InChI | InChI=1S/C24H35N3O4S2.CH4O/c1-4-6-7-11-17-30-22-21(25-33-26-22)20(15-12-16-28)18-27(3)23(31-24(29)32-5-2)19-13-9-8-10-14-19;1-2/h8-10,13-15,23,28H,4-7,11-12,16-18H2,1-3H3;2H,1H3/b20-15+; |
| InChIKey | MKLCXLNZKKQVIY-QMGGKDRNSA-N |
| XLogP | 5.39 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|