C44H80ClNO3 — CID 68979385
(Z)-octadec-9-en-1-ol;[(Z)-octadec-9-enyl] (2S)-2-amino-2-phenylacetate;hydrochloride (PubChem CID 68979385) has the molecular formula C44H80ClNO3 and a molecular weight of 706.58 g/mol. Its IUPAC name is (Z)-octadec-9-en-1-ol;[(Z)-octadec-9-enyl] (2S)-2-amino-2-phenylacetate;hydrochloride.
| Compound Name | (Z)-octadec-9-en-1-ol;[(Z)-octadec-9-enyl] (2S)-2-amino-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 68979385 |
| Molecular Formula | C44H80ClNO3 |
| Molecular Weight | 706.58 g/mol |
| Exact Mass | 705.58 |
| IUPAC Name | (Z)-octadec-9-en-1-ol;[(Z)-octadec-9-enyl] (2S)-2-amino-2-phenylacetate;hydrochloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO.CCCCCCCC/C=C\CCCCCCCCOC(=O)[C@@H](N)c1ccccc1.Cl |
| InChI | InChI=1S/C26H43NO2.C18H36O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-29-26(28)25(27)24-21-18-17-19-22-24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10,17-19,21-22,25H,2-8,11-16,20,23,27H2,1H3;9-10,19H,2-8,11-18H2,1H3;1H/b2*10-9-;/t25-;;/m0../s1 |
| InChIKey | VULMJBYBCWOLGQ-GEFZAKMZSA-N |
| XLogP | 13.71 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.58 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|