C14H18N3OS+ — CID 139777237
3-hex-1-enoxy-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole (PubChem CID 139777237) has the molecular formula C14H18N3OS+ and a molecular weight of 276.39 g/mol. Its IUPAC name is 3-hex-1-enoxy-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole.
| Compound Name | 3-hex-1-enoxy-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 139777237 |
| Molecular Formula | C14H18N3OS+ |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-hex-1-enoxy-4-(1-methylpyridin-1-ium-3-yl)-1,2,5-thiadiazole |
| SMILES | CCCCC=COc1nsnc1-c1ccc[n+](C)c1 |
| InChI | InChI=1S/C14H18N3OS/c1-3-4-5-6-10-18-14-13(15-19-16-14)12-8-7-9-17(2)11-12/h6-11H,3-5H2,1-2H3/q+1 |
| InChIKey | NTWOZMUNRALWPA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|