C13H19N3OS+2 — CID 172824580
5-(1-methylpyridin-1-ium-3-yl)-1-pentoxy-1,2,4-thiadiazol-1-ium (PubChem CID 172824580) has the molecular formula C13H19N3OS+2 and a molecular weight of 265.38 g/mol. Its IUPAC name is 5-(1-methylpyridin-1-ium-3-yl)-1-pentoxy-1,2,4-thiadiazol-1-ium.
| Compound Name | 5-(1-methylpyridin-1-ium-3-yl)-1-pentoxy-1,2,4-thiadiazol-1-ium |
|---|---|
| PubChem CID | 172824580 |
| Molecular Formula | C13H19N3OS+2 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-(1-methylpyridin-1-ium-3-yl)-1-pentoxy-1,2,4-thiadiazol-1-ium |
| SMILES | CCCCCO[s+]1ncnc1-c1ccc[n+](C)c1 |
| InChI | InChI=1S/C13H19N3OS/c1-3-4-5-9-17-18-13(14-11-15-18)12-7-6-8-16(2)10-12/h6-8,10-11H,3-5,9H2,1-2H3/q+2 |
| InChIKey | YQDOQMUZJBTKIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|