C23H29N2O+ — CID 12922323
4-hexoxy-1,2-dimethyl-3,5-diphenylpyrazol-2-ium (PubChem CID 12922323) has the molecular formula C23H29N2O+ and a molecular weight of 349.50 g/mol. Its IUPAC name is 4-hexoxy-1,2-dimethyl-3,5-diphenylpyrazol-2-ium.
| Compound Name | 4-hexoxy-1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
|---|---|
| PubChem CID | 12922323 |
| Molecular Formula | C23H29N2O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 4-hexoxy-1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
| SMILES | CCCCCCOc1c(-c2ccccc2)n(C)[n+](C)c1-c1ccccc1 |
| InChI | InChI=1S/C23H29N2O/c1-4-5-6-13-18-26-23-21(19-14-9-7-10-15-19)24(2)25(3)22(23)20-16-11-8-12-17-20/h7-12,14-17H,4-6,13,18H2,1-3H3/q+1 |
| InChIKey | OAVMLGZWOONFIW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|