C25H32N2O5S — CID 12922334
4-(cyclohexylmethoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium;methyl sulfate (PubChem CID 12922334) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium;methyl sulfate.
| Compound Name | 4-(cyclohexylmethoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium;methyl sulfate |
|---|---|
| PubChem CID | 12922334 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 4-(cyclohexylmethoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cn1c(-c2ccccc2)c(OCC2CCCCC2)c(-c2ccccc2)[n+]1C |
| InChI | InChI=1S/C24H29N2O.CH4O4S/c1-25-22(20-14-8-4-9-15-20)24(27-18-19-12-6-3-7-13-19)23(26(25)2)21-16-10-5-11-17-21;1-5-6(2,3)4/h4-5,8-11,14-17,19H,3,6-7,12-13,18H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | DBHCLHKOQBGCHB-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|