C20H20ClN2O+ — CID 57077242
4-(3-chloroprop-2-enoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium (PubChem CID 57077242) has the molecular formula C20H20ClN2O+ and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-(3-chloroprop-2-enoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium.
| Compound Name | 4-(3-chloroprop-2-enoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
|---|---|
| PubChem CID | 57077242 |
| Molecular Formula | C20H20ClN2O+ |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(3-chloroprop-2-enoxy)-1,2-dimethyl-3,5-diphenylpyrazol-2-ium |
| SMILES | Cn1c(-c2ccccc2)c(OCC=CCl)c(-c2ccccc2)[n+]1C |
| InChI | InChI=1S/C20H20ClN2O/c1-22-18(16-10-5-3-6-11-16)20(24-15-9-14-21)19(23(22)2)17-12-7-4-8-13-17/h3-14H,15H2,1-2H3/q+1 |
| InChIKey | HQDIGOKJVRPCFY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|