C12H16IN3 — CID 158323889
1,2,4-trimethyl-5-phenylpyrazol-2-ium-3-amine iodide (PubChem CID 158323889) has the molecular formula C12H16IN3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-phenylpyrazol-2-ium-3-amine iodide.
| Compound Name | 1,2,4-trimethyl-5-phenylpyrazol-2-ium-3-amine iodide |
|---|---|
| PubChem CID | 158323889 |
| Molecular Formula | C12H16IN3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1,2,4-trimethyl-5-phenylpyrazol-2-ium-3-amine iodide |
| SMILES | Cc1c(-c2ccccc2)n(C)[n+](C)c1N.[I-] |
| InChI | InChI=1S/C12H15N3.HI/c1-9-11(10-7-5-4-6-8-10)14(2)15(3)12(9)13;/h4-8,13H,1-3H3;1H |
| InChIKey | GPEDHZZOTKTSEA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|