C19H21N2+ — CID 154242726
3-(3,4-dimethylphenyl)-1,2-dimethyl-5-phenylpyrazol-2-ium (PubChem CID 154242726) has the molecular formula C19H21N2+ and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1,2-dimethyl-5-phenylpyrazol-2-ium.
| Compound Name | 3-(3,4-dimethylphenyl)-1,2-dimethyl-5-phenylpyrazol-2-ium |
|---|---|
| PubChem CID | 154242726 |
| Molecular Formula | C19H21N2+ |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1,2-dimethyl-5-phenylpyrazol-2-ium |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)n(C)[n+]2C)cc1C |
| InChI | InChI=1S/C19H21N2/c1-14-10-11-17(12-15(14)2)19-13-18(20(3)21(19)4)16-8-6-5-7-9-16/h5-13H,1-4H3/q+1 |
| InChIKey | PQRZRJIUOJTUJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|