C20H17I — CID 139318667
4-(3,4-dimethylphenyl)-1-iodo-2-phenylbenzene (PubChem CID 139318667) has the molecular formula C20H17I and a molecular weight of 384.26 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-1-iodo-2-phenylbenzene.
| Compound Name | 4-(3,4-dimethylphenyl)-1-iodo-2-phenylbenzene |
|---|---|
| PubChem CID | 139318667 |
| Molecular Formula | C20H17I |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-1-iodo-2-phenylbenzene |
| SMILES | Cc1ccc(-c2ccc(I)c(-c3ccccc3)c2)cc1C |
| InChI | InChI=1S/C20H17I/c1-14-8-9-17(12-15(14)2)18-10-11-20(21)19(13-18)16-6-4-3-5-7-16/h3-13H,1-2H3 |
| InChIKey | WTIVTZOEAVOHMY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|