About 1-iodo-2-methyl-3,5-diphenylbenzene
1-iodo-2-methyl-3,5-diphenylbenzene (PubChem CID 167224590) has the molecular formula C19H15I
and a molecular weight of 370.23 g/mol. Its IUPAC name is 1-iodo-2-methyl-3,5-diphenylbenzene.
Molecular Properties
| Compound Name | 1-iodo-2-methyl-3,5-diphenylbenzene |
| PubChem CID | 167224590 |
| Molecular Formula | C19H15I |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-iodo-2-methyl-3,5-diphenylbenzene |
| SMILES | Cc1c(I)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C19H15I/c1-14-18(16-10-6-3-7-11-16)12-17(13-19(14)20)15-8-4-2-5-9-15/h2-13H,1H3 |
| InChIKey | DTRGHQNCNGGUOK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-methyl-3,5-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-methyl-3,5-diphenylbenzene?
The IUPAC name of 1-iodo-2-methyl-3,5-diphenylbenzene (CID 167224590) is 1-iodo-2-methyl-3,5-diphenylbenzene.
What is the SMILES notation for 1-iodo-2-methyl-3,5-diphenylbenzene?
The canonical SMILES for 1-iodo-2-methyl-3,5-diphenylbenzene is Cc1c(I)cc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of 1-iodo-2-methyl-3,5-diphenylbenzene?
The InChIKey is DTRGHQNCNGGUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15I/c1-14-18(16-10-6-3-7-11-16)12-17(13-19(14)20)15-8-4-2-5-9-15/h2-13H,1H3.
What are the key properties of 1-iodo-2-methyl-3,5-diphenylbenzene?
1-iodo-2-methyl-3,5-diphenylbenzene has a molecular weight of 370.23 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-methyl-3,5-diphenylbenzene is sourced from PubChem (CID 167224590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).