C21H19I — CID 170131212
1-iodo-2,3-dimethyl-4-(3-methyl-4-phenylphenyl)benzene (PubChem CID 170131212) has the molecular formula C21H19I and a molecular weight of 398.29 g/mol. Its IUPAC name is 1-iodo-2,3-dimethyl-4-(3-methyl-4-phenylphenyl)benzene.
| Compound Name | 1-iodo-2,3-dimethyl-4-(3-methyl-4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 170131212 |
| Molecular Formula | C21H19I |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-iodo-2,3-dimethyl-4-(3-methyl-4-phenylphenyl)benzene |
| SMILES | Cc1cc(-c2ccc(I)c(C)c2C)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H19I/c1-14-13-18(20-11-12-21(22)16(3)15(20)2)9-10-19(14)17-7-5-4-6-8-17/h4-13H,1-3H3 |
| InChIKey | VBWHJZQZWPRJNR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|