About 1,2-dimethyl-4-phenylbenzene;2H-triazole
1,2-dimethyl-4-phenylbenzene;2H-triazole (PubChem CID 158820785) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1,2-dimethyl-4-phenylbenzene;2H-triazole.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-phenylbenzene;2H-triazole |
| PubChem CID | 158820785 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1,2-dimethyl-4-phenylbenzene;2H-triazole |
| SMILES | Cc1ccc(-c2ccccc2)cc1C.c1cn[nH]n1 |
| InChI | InChI=1S/C14H14.C2H3N3/c1-11-8-9-14(10-12(11)2)13-6-4-3-5-7-13;1-2-4-5-3-1/h3-10H,1-2H3;1-2H,(H,3,4,5) |
| InChIKey | IVVMYANEWZHNMB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-4-phenylbenzene;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-phenylbenzene;2H-triazole?
The IUPAC name of 1,2-dimethyl-4-phenylbenzene;2H-triazole (CID 158820785) is 1,2-dimethyl-4-phenylbenzene;2H-triazole.
What is the SMILES notation for 1,2-dimethyl-4-phenylbenzene;2H-triazole?
The canonical SMILES for 1,2-dimethyl-4-phenylbenzene;2H-triazole is Cc1ccc(-c2ccccc2)cc1C.c1cn[nH]n1.
What is the InChIKey of 1,2-dimethyl-4-phenylbenzene;2H-triazole?
The InChIKey is IVVMYANEWZHNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H3N3/c1-11-8-9-14(10-12(11)2)13-6-4-3-5-7-13;1-2-4-5-3-1/h3-10H,1-2H3;1-2H,(H,3,4,5).
What are the key properties of 1,2-dimethyl-4-phenylbenzene;2H-triazole?
1,2-dimethyl-4-phenylbenzene;2H-triazole has a molecular weight of 251.33 g/mol, XLogP of 3.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-phenylbenzene;2H-triazole is sourced from PubChem (CID 158820785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).