C9H7Cl2N3O2 — CID 23730934
6-chloro-5-pyridin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride (PubChem CID 23730934) has the molecular formula C9H7Cl2N3O2 and a molecular weight of 260.08 g/mol. Its IUPAC name is 6-chloro-5-pyridin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride.
| Compound Name | 6-chloro-5-pyridin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 23730934 |
| Molecular Formula | C9H7Cl2N3O2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 6-chloro-5-pyridin-3-yl-1H-pyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=c1[nH]c(Cl)c(-c2cccnc2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H6ClN3O2.ClH/c10-7-6(5-2-1-3-11-4-5)8(14)13-9(15)12-7;/h1-4H,(H2,12,13,14,15);1H |
| InChIKey | DGKMJYDNSAPXMA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |