C11H4ClF4N — CID 46317217
3-(4-chloro-2,3,5,6-tetrafluorophenyl)pyridine (PubChem CID 46317217) has the molecular formula C11H4ClF4N and a molecular weight of 261.61 g/mol. Its IUPAC name is 3-(4-chloro-2,3,5,6-tetrafluorophenyl)pyridine.
| Compound Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)pyridine |
|---|---|
| PubChem CID | 46317217 |
| Molecular Formula | C11H4ClF4N |
| Molecular Weight | 261.61 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)pyridine |
| SMILES | Fc1c(F)c(-c2cccnc2)c(F)c(F)c1Cl |
| InChI | InChI=1S/C11H4ClF4N/c12-7-10(15)8(13)6(9(14)11(7)16)5-2-1-3-17-4-5/h1-4H |
| InChIKey | JGAJVWHYSDVNNB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|