C40H21F7N2 — CID 143825285
3-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5-trifluorophenyl]pyridine (PubChem CID 143825285) has the molecular formula C40H21F7N2 and a molecular weight of 662.61 g/mol. Its IUPAC name is 3-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5-trifluorophenyl]pyridine.
| Compound Name | 3-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5-trifluorophenyl]pyridine |
|---|---|
| PubChem CID | 143825285 |
| Molecular Formula | C40H21F7N2 |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 3-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5-trifluorophenyl]pyridine |
| SMILES | Fc1cc(-c2cccnc2)c(F)c(-c2cc(-c3ccccc3)c(-c3c(F)c(F)c(F)c(-c4cccnc4)c3F)cc2-c2ccccc2)c1F |
| InChI | InChI=1S/C40H21F7N2/c41-31-19-28(24-13-7-15-48-20-24)35(42)33(36(31)43)29-17-27(23-11-5-2-6-12-23)30(18-26(29)22-9-3-1-4-10-22)34-37(44)32(25-14-8-16-49-21-25)38(45)40(47)39(34)46/h1-21H |
| InChIKey | NDEZHKJWEKXQBN-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|