About 3-(2,6-dibromophenyl)pyridine
3-(2,6-dibromophenyl)pyridine (PubChem CID 76539776) has the molecular formula C11H7Br2N
and a molecular weight of 312.99 g/mol. Its IUPAC name is 3-(2,6-dibromophenyl)pyridine.
Molecular Properties
| Compound Name | 3-(2,6-dibromophenyl)pyridine |
| PubChem CID | 76539776 |
| Molecular Formula | C11H7Br2N |
| Molecular Weight | 312.99 g/mol |
| Exact Mass | 310.89 |
| IUPAC Name | 3-(2,6-dibromophenyl)pyridine |
| SMILES | Brc1cccc(Br)c1-c1cccnc1 |
| InChI | InChI=1S/C11H7Br2N/c12-9-4-1-5-10(13)11(9)8-3-2-6-14-7-8/h1-7H |
| InChIKey | HRQSIFUYNAWXMZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.99 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,6-dibromophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dibromophenyl)pyridine?
The IUPAC name of 3-(2,6-dibromophenyl)pyridine (CID 76539776) is 3-(2,6-dibromophenyl)pyridine.
What is the SMILES notation for 3-(2,6-dibromophenyl)pyridine?
The canonical SMILES for 3-(2,6-dibromophenyl)pyridine is Brc1cccc(Br)c1-c1cccnc1.
What is the InChIKey of 3-(2,6-dibromophenyl)pyridine?
The InChIKey is HRQSIFUYNAWXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Br2N/c12-9-4-1-5-10(13)11(9)8-3-2-6-14-7-8/h1-7H.
What are the key properties of 3-(2,6-dibromophenyl)pyridine?
3-(2,6-dibromophenyl)pyridine has a molecular weight of 312.99 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dibromophenyl)pyridine is sourced from PubChem (CID 76539776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).